C22H42BrNOS — CID 19965713
3-(2-hexadecoxypropyl)-1,3-thiazol-3-ium bromide (PubChem CID 19965713) has the molecular formula C22H42BrNOS and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-(2-hexadecoxypropyl)-1,3-thiazol-3-ium bromide.
| Compound Name | 3-(2-hexadecoxypropyl)-1,3-thiazol-3-ium bromide |
|---|---|
| PubChem CID | 19965713 |
| Molecular Formula | C22H42BrNOS |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-(2-hexadecoxypropyl)-1,3-thiazol-3-ium bromide |
| SMILES | CCCCCCCCCCCCCCCCOC(C)C[n+]1ccsc1.[Br-] |
| InChI | InChI=1S/C22H42NOS.BrH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-24-22(2)20-23-17-19-25-21-23;/h17,19,21-22H,3-16,18,20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YKRZUGJNZUASKJ-UHFFFAOYSA-M |
| XLogP | 3.93 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|