C21H35NO3 — CID 19966481
1-[6-[(E)-3-hydroxyundec-1-enyl]-2-pyridinyl]pentane-1,5-diol (PubChem CID 19966481) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-[6-[(E)-3-hydroxyundec-1-enyl]-2-pyridinyl]pentane-1,5-diol.
| Compound Name | 1-[6-[(E)-3-hydroxyundec-1-enyl]-2-pyridinyl]pentane-1,5-diol |
|---|---|
| PubChem CID | 19966481 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 1-[6-[(E)-3-hydroxyundec-1-enyl]-2-pyridinyl]pentane-1,5-diol |
| SMILES | CCCCCCCCC(O)/C=C/c1cccc(C(O)CCCCO)n1 |
| InChI | InChI=1S/C21H35NO3/c1-2-3-4-5-6-7-12-19(24)16-15-18-11-10-13-20(22-18)21(25)14-8-9-17-23/h10-11,13,15-16,19,21,23-25H,2-9,12,14,17H2,1H3/b16-15+ |
| InChIKey | UVUZPXCUYICNRT-FOCLMDBBSA-N |
| XLogP | 4.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|