C22H35NO2 — CID 19897425
(E)-1-[6-[(E)-6-hydroxyhex-1-enyl]-2-pyridinyl]undec-1-en-3-ol (PubChem CID 19897425) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (E)-1-[6-[(E)-6-hydroxyhex-1-enyl]-2-pyridinyl]undec-1-en-3-ol.
| Compound Name | (E)-1-[6-[(E)-6-hydroxyhex-1-enyl]-2-pyridinyl]undec-1-en-3-ol |
|---|---|
| PubChem CID | 19897425 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | (E)-1-[6-[(E)-6-hydroxyhex-1-enyl]-2-pyridinyl]undec-1-en-3-ol |
| SMILES | CCCCCCCCC(O)/C=C/c1cccc(/C=C/CCCCO)n1 |
| InChI | InChI=1S/C22H35NO2/c1-2-3-4-5-6-10-16-22(25)18-17-21-15-12-14-20(23-21)13-9-7-8-11-19-24/h9,12-15,17-18,22,24-25H,2-8,10-11,16,19H2,1H3/b13-9+,18-17+ |
| InChIKey | NZJNPVPCLDIYDS-OEMZLLKESA-N |
| XLogP | 5.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|