C7H12N4O — CID 19966927
2-(1H-1,2,4-triazol-5-ylmethyl)morpholine (PubChem CID 19966927) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylmethyl)morpholine.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylmethyl)morpholine |
|---|---|
| PubChem CID | 19966927 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylmethyl)morpholine |
| SMILES | c1n[nH]c(CC2CNCCO2)n1 |
| InChI | InChI=1S/C7H12N4O/c1-2-12-6(4-8-1)3-7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11) |
| InChIKey | AZVVULZYHHKFJS-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |