About 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride
2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride (PubChem CID 86811670) has the molecular formula C7H14Cl2N4O
and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride |
| PubChem CID | 86811670 |
| Molecular Formula | C7H14Cl2N4O |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cnnc1C1CNCCO1 |
| InChI | InChI=1S/C7H12N4O.2ClH/c1-11-5-9-10-7(11)6-4-8-2-3-12-6;;/h5-6,8H,2-4H2,1H3;2*1H |
| InChIKey | ZGWNPJNFHYGTGZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride?
The IUPAC name of 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride (CID 86811670) is 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride.
What is the SMILES notation for 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride?
The canonical SMILES for 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride is Cl.Cl.Cn1cnnc1C1CNCCO1.
What is the InChIKey of 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride?
The InChIKey is ZGWNPJNFHYGTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O.2ClH/c1-11-5-9-10-7(11)6-4-8-2-3-12-6;;/h5-6,8H,2-4H2,1H3;2*1H.
What are the key properties of 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride?
2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride has a molecular weight of 241.12 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,2,4-triazol-3-yl)morpholine;dihydrochloride is sourced from PubChem (CID 86811670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).