C12H19F3N4O2 — CID 129000352
2-(4-ethyl-1,2,4-triazol-3-yl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine (PubChem CID 129000352) has the molecular formula C12H19F3N4O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-(4-ethyl-1,2,4-triazol-3-yl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine.
| Compound Name | 2-(4-ethyl-1,2,4-triazol-3-yl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 129000352 |
| Molecular Formula | C12H19F3N4O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(4-ethyl-1,2,4-triazol-3-yl)-4-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine |
| SMILES | CCn1cnnc1C1CN(CCOCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C12H19F3N4O2/c1-2-19-9-16-17-11(19)10-7-18(4-6-21-10)3-5-20-8-12(13,14)15/h9-10H,2-8H2,1H3 |
| InChIKey | HOMVRYJOHRYJAK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|