C23H25F4N7O — CID 19967003
4-[2-[ethyl(piperazin-2-yl)amino]-4-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 19967003) has the molecular formula C23H25F4N7O and a molecular weight of 491.49 g/mol. Its IUPAC name is 4-[2-[ethyl(piperazin-2-yl)amino]-4-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[2-[ethyl(piperazin-2-yl)amino]-4-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 19967003 |
| Molecular Formula | C23H25F4N7O |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 4-[2-[ethyl(piperazin-2-yl)amino]-4-pyridinyl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | CCN(c1cc(-c2ccnc(Nc3cccc(OC(F)(F)C(F)F)c3)n2)ccn1)C1CNCCN1 |
| InChI | InChI=1S/C23H25F4N7O/c1-2-34(20-14-28-10-11-30-20)19-12-15(6-8-29-19)18-7-9-31-22(33-18)32-16-4-3-5-17(13-16)35-23(26,27)21(24)25/h3-9,12-13,20-21,28,30H,2,10-11,14H2,1H3,(H,31,32,33) |
| InChIKey | MGKKDYJDZPEJDP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|