C20H28N3O9+ — CID 19969203
(2-acetyloxy-3-carboxypropyl)-dimethyl-[[3-[2-(4-nitrophenyl)ethoxy]-3-oxopropyl]carbamoyl]azanium (PubChem CID 19969203) has the molecular formula C20H28N3O9+ and a molecular weight of 454.46 g/mol. Its IUPAC name is (2-acetyloxy-3-carboxypropyl)-dimethyl-[[3-[2-(4-nitrophenyl)ethoxy]-3-oxopropyl]carbamoyl]azanium.
| Compound Name | (2-acetyloxy-3-carboxypropyl)-dimethyl-[[3-[2-(4-nitrophenyl)ethoxy]-3-oxopropyl]carbamoyl]azanium |
|---|---|
| PubChem CID | 19969203 |
| Molecular Formula | C20H28N3O9+ |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (2-acetyloxy-3-carboxypropyl)-dimethyl-[[3-[2-(4-nitrophenyl)ethoxy]-3-oxopropyl]carbamoyl]azanium |
| SMILES | CC(=O)OC(CC(=O)O)C[N+](C)(C)C(=O)NCCC(=O)OCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H27N3O9/c1-14(24)32-17(12-18(25)26)13-23(2,3)20(28)21-10-8-19(27)31-11-9-15-4-6-16(7-5-15)22(29)30/h4-7,17H,8-13H2,1-3H3,(H-,21,25,26,28)/p+1 |
| InChIKey | VACZBWLHRNCCDO-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|