C24H35N3O9 — CID 19969192
3-acetyloxy-4-[dimethyl-[[6-[1-(4-nitrophenyl)propan-2-yloxy]-6-oxohexyl]carbamoyl]azaniumyl]butanoate (PubChem CID 19969192) has the molecular formula C24H35N3O9 and a molecular weight of 509.56 g/mol. Its IUPAC name is 3-acetyloxy-4-[dimethyl-[[6-[1-(4-nitrophenyl)propan-2-yloxy]-6-oxohexyl]carbamoyl]azaniumyl]butanoate.
| Compound Name | 3-acetyloxy-4-[dimethyl-[[6-[1-(4-nitrophenyl)propan-2-yloxy]-6-oxohexyl]carbamoyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 19969192 |
| Molecular Formula | C24H35N3O9 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 3-acetyloxy-4-[dimethyl-[[6-[1-(4-nitrophenyl)propan-2-yloxy]-6-oxohexyl]carbamoyl]azaniumyl]butanoate |
| SMILES | CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C(=O)NCCCCCC(=O)OC(C)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H35N3O9/c1-17(14-19-9-11-20(12-10-19)26(33)34)35-23(31)8-6-5-7-13-25-24(32)27(3,4)16-21(15-22(29)30)36-18(2)28/h9-12,17,21H,5-8,13-16H2,1-4H3,(H-,25,29,30,32) |
| InChIKey | ITLVFDKPMHOBJB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|