C14H14BrNO7 — CID 88603781
3-bromo-5-[1-(4-nitrophenyl)propan-2-yloxy]-2,5-dioxopentanoic acid (PubChem CID 88603781) has the molecular formula C14H14BrNO7 and a molecular weight of 388.17 g/mol. Its IUPAC name is 3-bromo-5-[1-(4-nitrophenyl)propan-2-yloxy]-2,5-dioxopentanoic acid.
| Compound Name | 3-bromo-5-[1-(4-nitrophenyl)propan-2-yloxy]-2,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 88603781 |
| Molecular Formula | C14H14BrNO7 |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 3-bromo-5-[1-(4-nitrophenyl)propan-2-yloxy]-2,5-dioxopentanoic acid |
| SMILES | CC(Cc1ccc([N+](=O)[O-])cc1)OC(=O)CC(Br)C(=O)C(=O)O |
| InChI | InChI=1S/C14H14BrNO7/c1-8(6-9-2-4-10(5-3-9)16(21)22)23-12(17)7-11(15)13(18)14(19)20/h2-5,8,11H,6-7H2,1H3,(H,19,20) |
| InChIKey | JUKXQGAJHOMDDJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|