C19H20F3N5O7S — CID 19970552
2-N-[2-[2-(2-hydroxyethyl)hydrazinyl]acetyl]-5-N-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylpyridine-2,5-dicarboxamide (PubChem CID 19970552) has the molecular formula C19H20F3N5O7S and a molecular weight of 519.46 g/mol. Its IUPAC name is 2-N-[2-[2-(2-hydroxyethyl)hydrazinyl]acetyl]-5-N-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N-[2-[2-(2-hydroxyethyl)hydrazinyl]acetyl]-5-N-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970552 |
| Molecular Formula | C19H20F3N5O7S |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 2-N-[2-[2-(2-hydroxyethyl)hydrazinyl]acetyl]-5-N-[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylpyridine-2,5-dicarboxamide |
| SMILES | O=C(CNNCCO)NC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(OCC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C19H20F3N5O7S/c20-19(21,22)11-34-13-2-4-14(5-3-13)35(32,33)27-17(30)12-1-6-15(23-9-12)18(31)26-16(29)10-25-24-7-8-28/h1-6,9,24-25,28H,7-8,10-11H2,(H,27,30)(H,26,29,31) |
| InChIKey | ZWTCECABXQUDEZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|