C17H18F3N3O5S — CID 19970370
N-(3-hydroxypropyl)-5-[[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylamino]pyridine-2-carboxamide (PubChem CID 19970370) has the molecular formula C17H18F3N3O5S and a molecular weight of 433.41 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-5-[[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylamino]pyridine-2-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-5-[[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19970370 |
| Molecular Formula | C17H18F3N3O5S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-(3-hydroxypropyl)-5-[[4-(2,2,2-trifluoroethoxy)phenyl]sulfonylamino]pyridine-2-carboxamide |
| SMILES | O=C(NCCCO)c1ccc(NS(=O)(=O)c2ccc(OCC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C17H18F3N3O5S/c18-17(19,20)11-28-13-3-5-14(6-4-13)29(26,27)23-12-2-7-15(22-10-12)16(25)21-8-1-9-24/h2-7,10,23-24H,1,8-9,11H2,(H,21,25) |
| InChIKey | LGEFJMOTBKURDH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|