About CID 19971957
CID 19971957 (PubChem CID 19971957) has the molecular formula C28H34O2Si
and a molecular weight of 430.66 g/mol.
Molecular Properties
| Compound Name | CID 19971957 |
| PubChem CID | 19971957 |
| Molecular Formula | C28H34O2Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(OC[Si]C(c2ccccc2)c2ccccc2)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C28H34O2Si/c1-27(2,3)22-18-25(23(17-24(22)29)28(4,5)6)30-19-31-26(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-18,26,29H,19H2,1-6H3 |
| InChIKey | KCEHLBNJCVQOOQ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19971957 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19971957?
The IUPAC name of CID 19971957 (CID 19971957) is not available.
What is the SMILES notation for CID 19971957?
The canonical SMILES for CID 19971957 is CC(C)(C)c1cc(OC[Si]C(c2ccccc2)c2ccccc2)c(C(C)(C)C)cc1O.
What is the InChIKey of CID 19971957?
The InChIKey is KCEHLBNJCVQOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34O2Si/c1-27(2,3)22-18-25(23(17-24(22)29)28(4,5)6)30-19-31-26(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-18,26,29H,19H2,1-6H3.
What are the key properties of CID 19971957?
CID 19971957 has a molecular weight of 430.66 g/mol, XLogP of 6.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19971957 is sourced from PubChem (CID 19971957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).