About (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate
(4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate (PubChem CID 19972182) has the molecular formula C24H34O2Si
and a molecular weight of 382.62 g/mol. Its IUPAC name is (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate.
Molecular Properties
| Compound Name | (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate |
| PubChem CID | 19972182 |
| Molecular Formula | C24H34O2Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate |
| SMILES | CCCCc1ccc(OC(=O)c2ccc(CCCC[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H34O2Si/c1-5-6-9-20-13-17-23(18-14-20)26-24(25)22-15-11-21(12-16-22)10-7-8-19-27(2,3)4/h11-18H,5-10,19H2,1-4H3 |
| InChIKey | IXFLGIBPRCEWLL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate?
The IUPAC name of (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate (CID 19972182) is (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate.
What is the SMILES notation for (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate?
The canonical SMILES for (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate is CCCCc1ccc(OC(=O)c2ccc(CCCC[Si](C)(C)C)cc2)cc1.
What is the InChIKey of (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate?
The InChIKey is IXFLGIBPRCEWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O2Si/c1-5-6-9-20-13-17-23(18-14-20)26-24(25)22-15-11-21(12-16-22)10-7-8-19-27(2,3)4/h11-18H,5-10,19H2,1-4H3.
What are the key properties of (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate?
(4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate has a molecular weight of 382.62 g/mol, XLogP of 6.91, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butylphenyl) 4-(4-trimethylsilylbutyl)benzoate is sourced from PubChem (CID 19972182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).