C17H19F3N2O4S — CID 19974196
methyl 2-[4-[2-[[1-hydroxy-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethyl]amino]ethyl]phenoxy]acetate (PubChem CID 19974196) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is methyl 2-[4-[2-[[1-hydroxy-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethyl]amino]ethyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[2-[[1-hydroxy-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethyl]amino]ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19974196 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl 2-[4-[2-[[1-hydroxy-1-[2-(trifluoromethyl)-1,3-thiazol-4-yl]ethyl]amino]ethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CCNC(C)(O)c2csc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H19F3N2O4S/c1-16(24,13-10-27-15(22-13)17(18,19)20)21-8-7-11-3-5-12(6-4-11)26-9-14(23)25-2/h3-6,10,21,24H,7-9H2,1-2H3 |
| InChIKey | BRODSKLGCYWTQI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|