sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid

C8H7NaO5S — CID 19977753

IUPACsodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid
SMILESCc1[c-]c(S(=O)(=O)O)c(C(=O)O)cc1.[Na+]
InChIInChI=1S/C8H7O5S.Na/c1-5-2-3-6(8(9)10)7(4-5)14(11,12)13;/h2-3H,1H3,(H,9,10)(H,11,12,13);/q-1;+1
InChIKeyGCBSBYHDFKWQBQ-UHFFFAOYSA-N
MW238.20 g/mol
LogP-2.26
Rot. Bonds2

About sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid

sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid (PubChem CID 19977753) has the molecular formula C8H7NaO5S and a molecular weight of 238.20 g/mol. Its IUPAC name is sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid.

Molecular Properties

Compound Namesodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid
PubChem CID19977753
Molecular FormulaC8H7NaO5S
Molecular Weight238.20 g/mol
Exact Mass237.99
IUPAC Namesodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid
SMILESCc1[c-]c(S(=O)(=O)O)c(C(=O)O)cc1.[Na+]
InChIInChI=1S/C8H7O5S.Na/c1-5-2-3-6(8(9)10)7(4-5)14(11,12)13;/h2-3H,1H3,(H,9,10)(H,11,12,13);/q-1;+1
InChIKeyGCBSBYHDFKWQBQ-UHFFFAOYSA-N
XLogP-2.26
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.20
LogP ≤ 5-2.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid?
The IUPAC name of sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid (CID 19977753) is sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid.
What is the SMILES notation for sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid?
The canonical SMILES for sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid is Cc1[c-]c(S(=O)(=O)O)c(C(=O)O)cc1.[Na+].
What is the InChIKey of sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid?
The InChIKey is GCBSBYHDFKWQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O5S.Na/c1-5-2-3-6(8(9)10)7(4-5)14(11,12)13;/h2-3H,1H3,(H,9,10)(H,11,12,13);/q-1;+1.
What are the key properties of sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid?
sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid has a molecular weight of 238.20 g/mol, XLogP of -2.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-methyl-2-sulfobenzene-3-ide-1-carboxylic acid is sourced from PubChem (CID 19977753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).