C17H20F3N3OS2 — CID 19979627
1-tert-butyl-3-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]thiourea (PubChem CID 19979627) has the molecular formula C17H20F3N3OS2 and a molecular weight of 403.50 g/mol. Its IUPAC name is 1-tert-butyl-3-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]thiourea.
| Compound Name | 1-tert-butyl-3-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]thiourea |
|---|---|
| PubChem CID | 19979627 |
| Molecular Formula | C17H20F3N3OS2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 1-tert-butyl-3-[2,6-dimethyl-4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]oxy]phenyl]thiourea |
| SMILES | Cc1cc(Oc2nc(C(F)(F)F)cs2)cc(C)c1NC(=S)NC(C)(C)C |
| InChI | InChI=1S/C17H20F3N3OS2/c1-9-6-11(24-15-21-12(8-26-15)17(18,19)20)7-10(2)13(9)22-14(25)23-16(3,4)5/h6-8H,1-5H3,(H2,22,23,25) |
| InChIKey | IREWVIZQARZCRD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|