C10H12N2O2 — CID 19987344
3-methyl-4-(pyridin-2-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 19987344) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-methyl-4-(pyridin-2-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-methyl-4-(pyridin-2-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 19987344 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-methyl-4-(pyridin-2-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OCC1Cc1ccccn1 |
| InChI | InChI=1S/C10H12N2O2/c1-12-9(7-14-10(12)13)6-8-4-2-3-5-11-8/h2-5,9H,6-7H2,1H3 |
| InChIKey | HRMWTMABYFNQJW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |