C100H134O4S4 — CID 19990089
2,2,3,3-tetrakis[2-tert-butyl-4-(5-tert-butyl-2-methyl-4-sulfanylphenyl)-5-methylphenyl]dodecanedioic acid (PubChem CID 19990089) has the molecular formula C100H134O4S4 and a molecular weight of 1528.44 g/mol. Its IUPAC name is 2,2,3,3-tetrakis[2-tert-butyl-4-(5-tert-butyl-2-methyl-4-sulfanylphenyl)-5-methylphenyl]dodecanedioic acid.
| Compound Name | 2,2,3,3-tetrakis[2-tert-butyl-4-(5-tert-butyl-2-methyl-4-sulfanylphenyl)-5-methylphenyl]dodecanedioic acid |
|---|---|
| PubChem CID | 19990089 |
| Molecular Formula | C100H134O4S4 |
| Molecular Weight | 1528.44 g/mol |
| Exact Mass | 1526.92 |
| IUPAC Name | 2,2,3,3-tetrakis[2-tert-butyl-4-(5-tert-butyl-2-methyl-4-sulfanylphenyl)-5-methylphenyl]dodecanedioic acid |
| SMILES | Cc1cc(S)c(C(C)(C)C)cc1-c1cc(C(C)(C)C)c(C(CCCCCCCCC(=O)O)(c2cc(C)c(-c3cc(C(C)(C)C)c(S)cc3C)cc2C(C)(C)C)C(C(=O)O)(c2cc(C)c(-c3cc(C(C)(C)C)c(S)cc3C)cc2C(C)(C)C)c2cc(C)c(-c3cc(C(C)(C)C)c(S)cc3C)cc2C(C)(C)C)cc1C |
| InChI | InChI=1S/C100H134O4S4/c1-57-41-77(73(91(9,10)11)49-65(57)69-53-81(95(21,22)23)85(105)45-61(69)5)99(40-38-36-34-33-35-37-39-89(101)102,78-42-58(2)66(50-74(78)92(12,13)14)70-54-82(96(24,25)26)86(106)46-62(70)6)100(90(103)104,79-43-59(3)67(51-75(79)93(15,16)17)71-55-83(97(27,28)29)87(107)47-63(71)7)80-44-60(4)68(52-76(80)94(18,19)20)72-56-84(98(30,31)32)88(108)48-64(72)8/h41-56,105-108H,33-40H2,1-32H3,(H,101,102)(H,103,104) |
| InChIKey | OWEAEJUVXULGDQ-UHFFFAOYSA-N |
| XLogP | 28.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 108 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1528.44 |
| LogP ≤ 5 | 28.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|