C5H5NO4 — CID 19991631
5-methoxy-1,2-oxazole-3-carboxylic acid (PubChem CID 19991631) has the molecular formula C5H5NO4 and a molecular weight of 143.10 g/mol. Its IUPAC name is 5-methoxy-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-methoxy-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19991631 |
| Molecular Formula | C5H5NO4 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | 5-methoxy-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C5H5NO4/c1-9-4-2-3(5(7)8)6-10-4/h2H,1H3,(H,7,8) |
| InChIKey | ILSRUWJYXCEQCC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |