C19H16N4S — CID 19994518
[6-(cyanomethyl)-1-[2-(4-methylphenyl)ethyl]pyrrolo[1,2-a]pyrazin-8-yl] thiocyanate (PubChem CID 19994518) has the molecular formula C19H16N4S and a molecular weight of 332.43 g/mol. Its IUPAC name is [6-(cyanomethyl)-1-[2-(4-methylphenyl)ethyl]pyrrolo[1,2-a]pyrazin-8-yl] thiocyanate.
| Compound Name | [6-(cyanomethyl)-1-[2-(4-methylphenyl)ethyl]pyrrolo[1,2-a]pyrazin-8-yl] thiocyanate |
|---|---|
| PubChem CID | 19994518 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [6-(cyanomethyl)-1-[2-(4-methylphenyl)ethyl]pyrrolo[1,2-a]pyrazin-8-yl] thiocyanate |
| SMILES | Cc1ccc(CCc2nccn3c(CC#N)cc(SC#N)c23)cc1 |
| InChI | InChI=1S/C19H16N4S/c1-14-2-4-15(5-3-14)6-7-17-19-18(24-13-21)12-16(8-9-20)23(19)11-10-22-17/h2-5,10-12H,6-8H2,1H3 |
| InChIKey | STMFWQFFQIXCRJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|