C16H14Br2N2 — CID 15662103
6,8-dibromo-7-methyl-1-(2-phenylethyl)pyrrolo[1,2-a]pyrazine (PubChem CID 15662103) has the molecular formula C16H14Br2N2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 6,8-dibromo-7-methyl-1-(2-phenylethyl)pyrrolo[1,2-a]pyrazine.
| Compound Name | 6,8-dibromo-7-methyl-1-(2-phenylethyl)pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 15662103 |
| Molecular Formula | C16H14Br2N2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 6,8-dibromo-7-methyl-1-(2-phenylethyl)pyrrolo[1,2-a]pyrazine |
| SMILES | Cc1c(Br)c2c(CCc3ccccc3)nccn2c1Br |
| InChI | InChI=1S/C16H14Br2N2/c1-11-14(17)15-13(19-9-10-20(15)16(11)18)8-7-12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | ASDASOVFKLDNNZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |