C29H34N2O4 — CID 19994881
[2-[2-[4-(dibenzylamino)-3-methoxypiperidin-1-yl]ethyl]phenyl] hydrogen carbonate (PubChem CID 19994881) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is [2-[2-[4-(dibenzylamino)-3-methoxypiperidin-1-yl]ethyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[2-[4-(dibenzylamino)-3-methoxypiperidin-1-yl]ethyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 19994881 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | [2-[2-[4-(dibenzylamino)-3-methoxypiperidin-1-yl]ethyl]phenyl] hydrogen carbonate |
| SMILES | COC1CN(CCc2ccccc2OC(=O)O)CCC1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H34N2O4/c1-34-28-22-30(18-16-25-14-8-9-15-27(25)35-29(32)33)19-17-26(28)31(20-23-10-4-2-5-11-23)21-24-12-6-3-7-13-24/h2-15,26,28H,16-22H2,1H3,(H,32,33) |
| InChIKey | FLCQIMZJUQSMAJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|