About 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide
2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide (PubChem CID 19995116) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide.
Molecular Properties
| Compound Name | 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide |
| PubChem CID | 19995116 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)c(O)c1)NNc1ccccc1 |
| InChI | InChI=1S/C21H18N2O4/c24-19-13-17(11-12-18(19)21(26)15-7-3-1-4-8-15)27-14-20(25)23-22-16-9-5-2-6-10-16/h1-13,22,24H,14H2,(H,23,25) |
| InChIKey | ZRIYZIYWARNNMO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide?
The IUPAC name of 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide (CID 19995116) is 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide.
What is the SMILES notation for 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide?
The canonical SMILES for 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide is O=C(COc1ccc(C(=O)c2ccccc2)c(O)c1)NNc1ccccc1.
What is the InChIKey of 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide?
The InChIKey is ZRIYZIYWARNNMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c24-19-13-17(11-12-18(19)21(26)15-7-3-1-4-8-15)27-14-20(25)23-22-16-9-5-2-6-10-16/h1-13,22,24H,14H2,(H,23,25).
What are the key properties of 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide?
2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide has a molecular weight of 362.39 g/mol, XLogP of 3.15, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzoyl-3-hydroxyphenoxy)-N'-phenylacetohydrazide is sourced from PubChem (CID 19995116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).