About 2-benzylphenol
2-benzylphenol (PubChem CID 24216) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-benzylphenol.
Molecular Properties
| Compound Name | 2-benzylphenol |
| PubChem CID | 24216 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-benzylphenol |
| SMILES | Oc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H12O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | CDMGNVWZXRKJNS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylphenol?
The IUPAC name of 2-benzylphenol (CID 24216) is 2-benzylphenol.
What is the SMILES notation for 2-benzylphenol?
The canonical SMILES for 2-benzylphenol is Oc1ccccc1Cc1ccccc1.
What is the InChIKey of 2-benzylphenol?
The InChIKey is CDMGNVWZXRKJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,14H,10H2.
What are the key properties of 2-benzylphenol?
2-benzylphenol has a molecular weight of 184.24 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylphenol is sourced from PubChem (CID 24216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).