About 2-nitrobenzaldehyde
2-nitrobenzaldehyde (PubChem CID 11101) has the molecular formula C7H5NO3
and a molecular weight of 151.12 g/mol. Its IUPAC name is 2-nitrobenzaldehyde.
Molecular Properties
| Compound Name | 2-nitrobenzaldehyde |
| PubChem CID | 11101 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 2-nitrobenzaldehyde |
| SMILES | O=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5H |
| InChIKey | CMWKITSNTDAEDT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzaldehyde?
The IUPAC name of 2-nitrobenzaldehyde (CID 11101) is 2-nitrobenzaldehyde.
What is the SMILES notation for 2-nitrobenzaldehyde?
The canonical SMILES for 2-nitrobenzaldehyde is O=Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitrobenzaldehyde?
The InChIKey is CMWKITSNTDAEDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-5H.
What are the key properties of 2-nitrobenzaldehyde?
2-nitrobenzaldehyde has a molecular weight of 151.12 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzaldehyde is sourced from PubChem (CID 11101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).