About 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate
3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate (PubChem CID 200102) has the molecular formula C19H29NO2
and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-(diethylamino)propyl 1-phenylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate |
| PubChem CID | 200102 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 3-(diethylamino)propyl 1-phenylcyclopentane-1-carboxylate |
| SMILES | CCN(CC)CCCOC(=O)C1(CCCC1)C2=CC=CC=C2 |
| InChI | InChI=1S/C19H29NO2/c1-3-20(4-2)15-10-16-22-18(21)19(13-8-9-14-19)17-11-6-5-7-12-17/h5-7,11-12H,3-4,8-10,13-16H2,1-2H3 |
| InChIKey | CJUMSMMWZFHYSW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | 326 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate?
The IUPAC name of 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate (CID 200102) is 3-(diethylamino)propyl 1-phenylcyclopentane-1-carboxylate.
What is the SMILES notation for 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate?
The canonical SMILES for 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate is CCN(CC)CCCOC(=O)C1(CCCC1)C2=CC=CC=C2.
What is the InChIKey of 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate?
The InChIKey is CJUMSMMWZFHYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO2/c1-3-20(4-2)15-10-16-22-18(21)19(13-8-9-14-19)17-11-6-5-7-12-17/h5-7,11-12H,3-4,8-10,13-16H2,1-2H3.
What are the key properties of 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate?
3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate has a molecular weight of 303.40 g/mol, XLogP of 4.30, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(Diethylamino)propyl 1-phenylcyclopentane-1-carboxylate is sourced from PubChem (CID 200102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).