C17H25N5OS2 — CID 2002375
11-methyl-5-methylsulfanyl-N-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 2002375) has the molecular formula C17H25N5OS2 and a molecular weight of 379.56 g/mol. Its IUPAC name is 11-methyl-5-methylsulfanyl-N-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 11-methyl-5-methylsulfanyl-N-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 2002375 |
| Molecular Formula | C17H25N5OS2 |
| Molecular Weight | 379.56 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 11-methyl-5-methylsulfanyl-N-(2-morpholin-4-ylethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CSc1nc(NCCN2CCOCC2)c2c3c(sc2n1)CN(C)CC3 |
| InChI | InChI=1S/C17H25N5OS2/c1-21-5-3-12-13(11-21)25-16-14(12)15(19-17(20-16)24-2)18-4-6-22-7-9-23-10-8-22/h3-11H2,1-2H3,(H,18,19,20) |
| InChIKey | CSRXPWVENAQZEJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |