C22H34N4O2S2 — CID 2032520
(12R)-12-ethyl-12-methyl-N-(3-morpholin-4-ylpropyl)-5-propan-2-ylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 2032520) has the molecular formula C22H34N4O2S2 and a molecular weight of 450.67 g/mol. Its IUPAC name is (12R)-12-ethyl-12-methyl-N-(3-morpholin-4-ylpropyl)-5-propan-2-ylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | (12R)-12-ethyl-12-methyl-N-(3-morpholin-4-ylpropyl)-5-propan-2-ylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 2032520 |
| Molecular Formula | C22H34N4O2S2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (12R)-12-ethyl-12-methyl-N-(3-morpholin-4-ylpropyl)-5-propan-2-ylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CC[C@]1(C)Cc2c(sc3nc(SC(C)C)nc(NCCCN4CCOCC4)c23)CO1 |
| InChI | InChI=1S/C22H34N4O2S2/c1-5-22(4)13-16-17(14-28-22)30-20-18(16)19(24-21(25-20)29-15(2)3)23-7-6-8-26-9-11-27-12-10-26/h15H,5-14H2,1-4H3,(H,23,24,25)/t22-/m1/s1 |
| InChIKey | HLQNDXWCYGOHLH-JOCHJYFZSA-N |
| XLogP | 4.57 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|