C21H35N4OS2+ — CID 7530347
3-[[(12R)-5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]propyl-dimethylazanium (PubChem CID 7530347) has the molecular formula C21H35N4OS2+ and a molecular weight of 423.67 g/mol. Its IUPAC name is 3-[[(12R)-5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(12R)-5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7530347 |
| Molecular Formula | C21H35N4OS2+ |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-[[(12R)-5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]propyl-dimethylazanium |
| SMILES | CCCCSc1nc(NCCC[NH+](C)C)c2c3c(sc2n1)CO[C@](C)(CC)C3 |
| InChI | InChI=1S/C21H34N4OS2/c1-6-8-12-27-20-23-18(22-10-9-11-25(4)5)17-15-13-21(3,7-2)26-14-16(15)28-19(17)24-20/h6-14H2,1-5H3,(H,22,23,24)/p+1/t21-/m1/s1 |
| InChIKey | KYXAJDYQBKXAKG-OAQYLSRUSA-O |
| XLogP | 3.77 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|