C7H6F3N3O4S — CID 20060278
2-[[2-(Trifluoromethyl)-1,3-thiazole-4-carbonyl]amino]ethyl nitrate (PubChem CID 20060278) has the molecular formula C7H6F3N3O4S and a molecular weight of 285.20 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)-1,3-thiazole-4-carbonyl]amino]ethyl nitrate.
| Compound Name | 2-[[2-(Trifluoromethyl)-1,3-thiazole-4-carbonyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 20060278 |
| Molecular Formula | C7H6F3N3O4S |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-[[2-(trifluoromethyl)-1,3-thiazole-4-carbonyl]amino]ethyl nitrate |
| SMILES | C1=C(N=C(S1)C(F)(F)F)C(=O)NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C7H6F3N3O4S/c8-7(9,10)6-12-4(3-18-6)5(14)11-1-2-17-13(15)16/h3H,1-2H2,(H,11,14) |
| InChIKey | FBAPSIYJPKHFSF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 322 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|