C6H7FN2OS — CID 67765171
N-ethyl-2-fluoro-1,3-thiazole-4-carboxamide (PubChem CID 67765171) has the molecular formula C6H7FN2OS and a molecular weight of 174.20 g/mol. Its IUPAC name is N-ethyl-2-fluoro-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethyl-2-fluoro-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67765171 |
| Molecular Formula | C6H7FN2OS |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | N-ethyl-2-fluoro-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(F)n1 |
| InChI | InChI=1S/C6H7FN2OS/c1-2-8-5(10)4-3-11-6(7)9-4/h3H,2H2,1H3,(H,8,10) |
| InChIKey | JKKSVCMMKFOQGR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |