C19H14Cl2N2O2 — CID 2010895
(3S)-1-(2,6-dichlorophenyl)-3-(1-methylindol-3-yl)pyrrolidine-2,5-dione (PubChem CID 2010895) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 373.24 g/mol. Its IUPAC name is (3S)-1-(2,6-dichlorophenyl)-3-(1-methylindol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,6-dichlorophenyl)-3-(1-methylindol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2010895 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (3S)-1-(2,6-dichlorophenyl)-3-(1-methylindol-3-yl)pyrrolidine-2,5-dione |
| SMILES | Cn1cc([C@@H]2CC(=O)N(c3c(Cl)cccc3Cl)C2=O)c2ccccc21 |
| InChI | InChI=1S/C19H14Cl2N2O2/c1-22-10-13(11-5-2-3-8-16(11)22)12-9-17(24)23(19(12)25)18-14(20)6-4-7-15(18)21/h2-8,10,12H,9H2,1H3/t12-/m0/s1 |
| InChIKey | VMBMYWQHFKRSJD-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|