C19H15N3O4 — CID 942919
(3S)-3-(1-methylindol-3-yl)-1-(3-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 942919) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is (3S)-3-(1-methylindol-3-yl)-1-(3-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(1-methylindol-3-yl)-1-(3-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 942919 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (3S)-3-(1-methylindol-3-yl)-1-(3-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | Cn1cc([C@@H]2CC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O4/c1-20-11-16(14-7-2-3-8-17(14)20)15-10-18(23)21(19(15)24)12-5-4-6-13(9-12)22(25)26/h2-9,11,15H,10H2,1H3/t15-/m0/s1 |
| InChIKey | FIPSIEAHWCPDJI-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|