C22H21BrN2O2 — CID 2032606
(3S)-1-(4-bromophenyl)-3-(1-butylindol-3-yl)pyrrolidine-2,5-dione (PubChem CID 2032606) has the molecular formula C22H21BrN2O2 and a molecular weight of 425.33 g/mol. Its IUPAC name is (3S)-1-(4-bromophenyl)-3-(1-butylindol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-bromophenyl)-3-(1-butylindol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2032606 |
| Molecular Formula | C22H21BrN2O2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (3S)-1-(4-bromophenyl)-3-(1-butylindol-3-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCn1cc([C@@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H21BrN2O2/c1-2-3-12-24-14-19(17-6-4-5-7-20(17)24)18-13-21(26)25(22(18)27)16-10-8-15(23)9-11-16/h4-11,14,18H,2-3,12-13H2,1H3/t18-/m0/s1 |
| InChIKey | CBBRMVMRGSPZJN-SFHVURJKSA-N |
| XLogP | 5.25 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|