C12H13ClFN2O3S- — CID 2011914
(2S)-2-[(3-chloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoate (PubChem CID 2011914) has the molecular formula C12H13ClFN2O3S- and a molecular weight of 319.77 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(3-chloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2011914 |
| Molecular Formula | C12H13ClFN2O3S- |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (2S)-2-[(3-chloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)Nc1ccc(F)c(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C12H14ClFN2O3S/c1-20-5-4-10(11(17)18)16-12(19)15-7-2-3-9(14)8(13)6-7/h2-3,6,10H,4-5H2,1H3,(H,17,18)(H2,15,16,19)/p-1/t10-/m0/s1 |
| InChIKey | HETIVEINKLURSJ-JTQLQIEISA-M |
| XLogP | 1.47 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |