C9H17N2O3- — CID 2015483
(2R)-2-(3-methylbutylcarbamoylamino)propanoate (PubChem CID 2015483) has the molecular formula C9H17N2O3- and a molecular weight of 201.25 g/mol. Its IUPAC name is (2R)-2-(3-methylbutylcarbamoylamino)propanoate.
| Compound Name | (2R)-2-(3-methylbutylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 2015483 |
| Molecular Formula | C9H17N2O3- |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2R)-2-(3-methylbutylcarbamoylamino)propanoate |
| SMILES | CC(C)CCNC(=O)N[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C9H18N2O3/c1-6(2)4-5-10-9(14)11-7(3)8(12)13/h6-7H,4-5H2,1-3H3,(H,12,13)(H2,10,11,14)/p-1/t7-/m1/s1 |
| InChIKey | VDORTNKBLISZGX-SSDOTTSWSA-M |
| XLogP | -0.53 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |