C22H18Cl2N3O3+ — CID 2018172
(3R,3'aR,8'aS,8'bS)-2'-(2,5-dichlorophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione (PubChem CID 2018172) has the molecular formula C22H18Cl2N3O3+ and a molecular weight of 443.31 g/mol. Its IUPAC name is (3R,3'aR,8'aS,8'bS)-2'-(2,5-dichlorophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione.
| Compound Name | (3R,3'aR,8'aS,8'bS)-2'-(2,5-dichlorophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
|---|---|
| PubChem CID | 2018172 |
| Molecular Formula | C22H18Cl2N3O3+ |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (3R,3'aR,8'aS,8'bS)-2'-(2,5-dichlorophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
| SMILES | O=C1[C@H]2[C@@H](C(=O)N1c1cc(Cl)ccc1Cl)[C@@]1(C(=O)Nc3ccccc31)[NH+]1CCC[C@@H]21 |
| InChI | InChI=1S/C22H17Cl2N3O3/c23-11-7-8-13(24)16(10-11)27-19(28)17-15-6-3-9-26(15)22(18(17)20(27)29)12-4-1-2-5-14(12)25-21(22)30/h1-2,4-5,7-8,10,15,17-18H,3,6,9H2,(H,25,30)/p+1/t15-,17+,18-,22-/m0/s1 |
| InChIKey | ATPCUYQGOXKMIT-PBWVOLNLSA-O |
| XLogP | 2.01 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|