C25H26N3O3+ — CID 11875662
(3S,3'aR,8'aS,8'bS)-2'-(2,4-dimethylphenyl)-5-methylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione (PubChem CID 11875662) has the molecular formula C25H26N3O3+ and a molecular weight of 416.50 g/mol. Its IUPAC name is (3S,3'aR,8'aS,8'bS)-2'-(2,4-dimethylphenyl)-5-methylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione.
| Compound Name | (3S,3'aR,8'aS,8'bS)-2'-(2,4-dimethylphenyl)-5-methylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
|---|---|
| PubChem CID | 11875662 |
| Molecular Formula | C25H26N3O3+ |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (3S,3'aR,8'aS,8'bS)-2'-(2,4-dimethylphenyl)-5-methylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@]2(C(=O)Nc4ccc(C)cc42)[NH+]2CCC[C@@H]32)c(C)c1 |
| InChI | InChI=1S/C25H25N3O3/c1-13-7-9-18(15(3)11-13)28-22(29)20-19-5-4-10-27(19)25(21(20)23(28)30)16-12-14(2)6-8-17(16)26-24(25)31/h6-9,11-12,19-21H,4-5,10H2,1-3H3,(H,26,31)/p+1/t19-,20+,21-,25+/m0/s1 |
| InChIKey | WVCQVSWAKIRRIC-UGCAPWQASA-O |
| XLogP | 1.63 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|