C25H25N4O5+ — CID 2048991
(3R,3'aR,8'aS,8'bS)-6,7-dimethyl-2'-(2-methyl-5-nitrophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione (PubChem CID 2048991) has the molecular formula C25H25N4O5+ and a molecular weight of 461.50 g/mol. Its IUPAC name is (3R,3'aR,8'aS,8'bS)-6,7-dimethyl-2'-(2-methyl-5-nitrophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione.
| Compound Name | (3R,3'aR,8'aS,8'bS)-6,7-dimethyl-2'-(2-methyl-5-nitrophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
|---|---|
| PubChem CID | 2048991 |
| Molecular Formula | C25H25N4O5+ |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3R,3'aR,8'aS,8'bS)-6,7-dimethyl-2'-(2-methyl-5-nitrophenyl)spiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(=O)[C@H]2[C@@H](C1=O)[C@@]1(C(=O)Nc3c1ccc(C)c3C)[NH+]1CCC[C@@H]21 |
| InChI | InChI=1S/C25H24N4O5/c1-12-7-9-16-21(14(12)3)26-24(32)25(16)20-19(17-5-4-10-27(17)25)22(30)28(23(20)31)18-11-15(29(33)34)8-6-13(18)2/h6-9,11,17,19-20H,4-5,10H2,1-3H3,(H,26,32)/p+1/t17-,19+,20-,25-/m0/s1 |
| InChIKey | QOZZZKKZISDQMQ-UJAPCULTSA-O |
| XLogP | 1.53 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|