C26H25ClN3O5+ — CID 6589190
ethyl 4-[(3S,3'aR,8'aR,8'bR)-6-chloro-7-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-2'-yl]benzoate (PubChem CID 6589190) has the molecular formula C26H25ClN3O5+ and a molecular weight of 494.96 g/mol. Its IUPAC name is ethyl 4-[(3S,3'aR,8'aR,8'bR)-6-chloro-7-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-2'-yl]benzoate.
| Compound Name | ethyl 4-[(3S,3'aR,8'aR,8'bR)-6-chloro-7-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-2'-yl]benzoate |
|---|---|
| PubChem CID | 6589190 |
| Molecular Formula | C26H25ClN3O5+ |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | ethyl 4-[(3S,3'aR,8'aR,8'bR)-6-chloro-7-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-2'-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H]4CCC[NH+]4[C@@]4(C(=O)Nc5c4ccc(Cl)c5C)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H24ClN3O5/c1-3-35-24(33)14-6-8-15(9-7-14)30-22(31)19-18-5-4-12-29(18)26(20(19)23(30)32)16-10-11-17(27)13(2)21(16)28-25(26)34/h6-11,18-20H,3-5,12H2,1-2H3,(H,28,34)/p+1/t18-,19+,20+,26-/m1/s1 |
| InChIKey | RDDGNSLBYTYWLW-WWMMDOJLSA-O |
| XLogP | 1.84 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|