C22H19ClN3O3+ — CID 2001873
(3S,3'aS,8'aR,8'bR)-5-chloro-2'-phenylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione (PubChem CID 2001873) has the molecular formula C22H19ClN3O3+ and a molecular weight of 408.87 g/mol. Its IUPAC name is (3S,3'aS,8'aR,8'bR)-5-chloro-2'-phenylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione.
| Compound Name | (3S,3'aS,8'aR,8'bR)-5-chloro-2'-phenylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
|---|---|
| PubChem CID | 2001873 |
| Molecular Formula | C22H19ClN3O3+ |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (3S,3'aS,8'aR,8'bR)-5-chloro-2'-phenylspiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
| SMILES | O=C1[C@H]2[C@H]3CCC[NH+]3[C@@]3(C(=O)Nc4ccc(Cl)cc43)[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3O3/c23-12-8-9-15-14(11-12)22(21(29)24-15)18-17(16-7-4-10-25(16)22)19(27)26(20(18)28)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,16-18H,4,7,10H2,(H,24,29)/p+1/t16-,17+,18-,22-/m1/s1 |
| InChIKey | WMLIDXMCWWRYCP-WYADAEROSA-O |
| XLogP | 1.35 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|