C20H23FN3O3+ — CID 11910648
(3S,3'aR,8'aS,8'bS)-2'-[(2S)-butan-2-yl]-5-fluorospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione (PubChem CID 11910648) has the molecular formula C20H23FN3O3+ and a molecular weight of 372.42 g/mol. Its IUPAC name is (3S,3'aR,8'aS,8'bS)-2'-[(2S)-butan-2-yl]-5-fluorospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione.
| Compound Name | (3S,3'aR,8'aS,8'bS)-2'-[(2S)-butan-2-yl]-5-fluorospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
|---|---|
| PubChem CID | 11910648 |
| Molecular Formula | C20H23FN3O3+ |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (3S,3'aR,8'aS,8'bS)-2'-[(2S)-butan-2-yl]-5-fluorospiro[1H-indole-3,4'-5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium]-1',2,3'-trione |
| SMILES | CC[C@H](C)N1C(=O)[C@H]2[C@@H](C1=O)[C@]1(C(=O)Nc3ccc(F)cc31)[NH+]1CCC[C@@H]21 |
| InChI | InChI=1S/C20H22FN3O3/c1-3-10(2)24-17(25)15-14-5-4-8-23(14)20(16(15)18(24)26)12-9-11(21)6-7-13(12)22-19(20)27/h6-7,9-10,14-16H,3-5,8H2,1-2H3,(H,22,27)/p+1/t10-,14-,15+,16-,20+/m0/s1 |
| InChIKey | XWLQFAKSDIEBEW-DUBGADTFSA-O |
| XLogP | 0.43 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|