C25H25N4O5+ — CID 6587210
(3aR,4R,8aS,8bS)-1'-ethyl-2-(2-methyl-3-nitrophenyl)spiro[5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium-4,3'-indole]-1,2',3-trione (PubChem CID 6587210) has the molecular formula C25H25N4O5+ and a molecular weight of 461.50 g/mol. Its IUPAC name is (3aR,4R,8aS,8bS)-1'-ethyl-2-(2-methyl-3-nitrophenyl)spiro[5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium-4,3'-indole]-1,2',3-trione.
| Compound Name | (3aR,4R,8aS,8bS)-1'-ethyl-2-(2-methyl-3-nitrophenyl)spiro[5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium-4,3'-indole]-1,2',3-trione |
|---|---|
| PubChem CID | 6587210 |
| Molecular Formula | C25H25N4O5+ |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3aR,4R,8aS,8bS)-1'-ethyl-2-(2-methyl-3-nitrophenyl)spiro[5,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-5-ium-4,3'-indole]-1,2',3-trione |
| SMILES | CCN1C(=O)[C@]2(c3ccccc31)[C@@H]1C(=O)N(c3cccc([N+](=O)[O-])c3C)C(=O)[C@@H]1[C@@H]1CCC[NH+]12 |
| InChI | InChI=1S/C25H24N4O5/c1-3-26-18-9-5-4-8-15(18)25(24(26)32)21-20(19-12-7-13-27(19)25)22(30)28(23(21)31)16-10-6-11-17(14(16)2)29(33)34/h4-6,8-11,19-21H,3,7,12-13H2,1-2H3/p+1/t19-,20+,21-,25-/m0/s1 |
| InChIKey | STZFWFBWYIPTPF-PDFGSZSQSA-O |
| XLogP | 1.33 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|