C33H30N2O5 — CID 2032300
(3S,3aR,6aS)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(2-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 2032300) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(2-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aS)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(2-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 2032300 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (3S,3aR,6aS)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(2-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCOc1cc([C@@H]2[C@H]3C(=O)N(c4ccccc4C)C(=O)[C@H]3ON2c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H30N2O5/c1-3-38-28-20-24(18-19-27(28)39-21-23-13-6-4-7-14-23)30-29-31(40-35(30)25-15-8-5-9-16-25)33(37)34(32(29)36)26-17-11-10-12-22(26)2/h4-20,29-31H,3,21H2,1-2H3/t29-,30-,31+/m1/s1 |
| InChIKey | YEQKIUHBYOXGIP-OLUZHXLYSA-N |
| XLogP | 6.02 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|