C32H27FN2O5 — CID 98359781
(3R,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98359781) has the molecular formula C32H27FN2O5 and a molecular weight of 538.58 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98359781 |
| Molecular Formula | C32H27FN2O5 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | (3R,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-(4-fluorophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCOc1cc([C@H]2[C@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@@H]3ON2c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H27FN2O5/c1-2-38-27-19-22(13-18-26(27)39-20-21-9-5-3-6-10-21)29-28-30(40-35(29)25-11-7-4-8-12-25)32(37)34(31(28)36)24-16-14-23(33)15-17-24/h3-19,28-30H,2,20H2,1H3/t28-,29+,30-/m1/s1 |
| InChIKey | KPHCPOAPZBEPFP-DYIKCSJPSA-N |
| XLogP | 5.85 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|