C36H30N2O5 — CID 98693304
(3S,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-naphthalen-1-yl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98693304) has the molecular formula C36H30N2O5 and a molecular weight of 570.65 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-naphthalen-1-yl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-naphthalen-1-yl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98693304 |
| Molecular Formula | C36H30N2O5 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (3S,3aR,6aR)-3-(3-ethoxy-4-phenylmethoxyphenyl)-5-naphthalen-1-yl-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCOc1cc([C@@H]2[C@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@@H]3ON2c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H30N2O5/c1-2-41-31-22-26(20-21-30(31)42-23-24-12-5-3-6-13-24)33-32-34(43-38(33)27-16-7-4-8-17-27)36(40)37(35(32)39)29-19-11-15-25-14-9-10-18-28(25)29/h3-22,32-34H,2,23H2,1H3/t32-,33-,34-/m1/s1 |
| InChIKey | CXTVRUVNZZWPLP-CKOYEXALSA-N |
| XLogP | 6.87 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|