C26H23ClO3 — CID 2032890
(2E)-2-[(4-tert-butylphenyl)methylidene]-6-[(2-chlorophenyl)methoxy]-1-benzofuran-3-one (PubChem CID 2032890) has the molecular formula C26H23ClO3 and a molecular weight of 418.92 g/mol. Its IUPAC name is (2E)-2-[(4-tert-butylphenyl)methylidene]-6-[(2-chlorophenyl)methoxy]-1-benzofuran-3-one.
| Compound Name | (2E)-2-[(4-tert-butylphenyl)methylidene]-6-[(2-chlorophenyl)methoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2032890 |
| Molecular Formula | C26H23ClO3 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (2E)-2-[(4-tert-butylphenyl)methylidene]-6-[(2-chlorophenyl)methoxy]-1-benzofuran-3-one |
| SMILES | CC(C)(C)c1ccc(/C=C2/Oc3cc(OCc4ccccc4Cl)ccc3C2=O)cc1 |
| InChI | InChI=1S/C26H23ClO3/c1-26(2,3)19-10-8-17(9-11-19)14-24-25(28)21-13-12-20(15-23(21)30-24)29-16-18-6-4-5-7-22(18)27/h4-15H,16H2,1-3H3/b24-14+ |
| InChIKey | RJXYSTWUMXLZOH-ZVHZXABRSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|