C27H31N6O4+ — CID 2033239
6-amino-7-[2-(4-methoxyphenyl)ethyl]-N-(2-morpholin-4-ylethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 2033239) has the molecular formula C27H31N6O4+ and a molecular weight of 503.58 g/mol. Its IUPAC name is 6-amino-7-[2-(4-methoxyphenyl)ethyl]-N-(2-morpholin-4-ylethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | 6-amino-7-[2-(4-methoxyphenyl)ethyl]-N-(2-morpholin-4-ylethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 2033239 |
| Molecular Formula | C27H31N6O4+ |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 6-amino-7-[2-(4-methoxyphenyl)ethyl]-N-(2-morpholin-4-ylethyl)-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | COc1ccc(CC[n+]2c(N)c(C(=O)NCCN3CCOCC3)cc3c(=O)n4ccccc4nc32)cc1 |
| InChI | InChI=1S/C27H30N6O4/c1-36-20-7-5-19(6-8-20)9-12-33-24(28)21(26(34)29-10-13-31-14-16-37-17-15-31)18-22-25(33)30-23-4-2-3-11-32(23)27(22)35/h2-8,11,18,28H,9-10,12-17H2,1H3,(H,29,34)/p+1 |
| InChIKey | WDBHAHBJUJZYNR-UHFFFAOYSA-O |
| XLogP | 1.03 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|