C25H25F3N4O2S — CID 2033547
(E)-N-(1,3-benzothiazol-2-yl)-3-(4-benzylpiperidin-1-yl)-2-(2,2,2-trifluoroacetyl)but-2-enehydrazide (PubChem CID 2033547) has the molecular formula C25H25F3N4O2S and a molecular weight of 502.56 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-(4-benzylpiperidin-1-yl)-2-(2,2,2-trifluoroacetyl)but-2-enehydrazide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(4-benzylpiperidin-1-yl)-2-(2,2,2-trifluoroacetyl)but-2-enehydrazide |
|---|---|
| PubChem CID | 2033547 |
| Molecular Formula | C25H25F3N4O2S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(4-benzylpiperidin-1-yl)-2-(2,2,2-trifluoroacetyl)but-2-enehydrazide |
| SMILES | C/C(=C(\C(=O)N(N)c1nc2ccccc2s1)C(=O)C(F)(F)F)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25F3N4O2S/c1-16(31-13-11-18(12-14-31)15-17-7-3-2-4-8-17)21(22(33)25(26,27)28)23(34)32(29)24-30-19-9-5-6-10-20(19)35-24/h2-10,18H,11-15,29H2,1H3/b21-16+ |
| InChIKey | TUSVZDNLWRRANG-LTGZKZEYSA-N |
| XLogP | 4.86 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|